C30H22ClN3O2 — CID 11016471
(E)-3-(4-chlorophenyl)-1-[4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]amino]phenyl]prop-2-en-1-one (PubChem CID 11016471) has the molecular formula C30H22ClN3O2 and a molecular weight of 491.98 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-1-[4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]amino]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4-chlorophenyl)-1-[4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]amino]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11016471 |
| Molecular Formula | C30H22ClN3O2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-1-[4-[[3-(4-methoxyphenyl)-1,8-naphthyridin-2-yl]amino]phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(-c2cc3cccnc3nc2Nc2ccc(C(=O)/C=C/c3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H22ClN3O2/c1-36-26-15-9-21(10-16-26)27-19-23-3-2-18-32-29(23)34-30(27)33-25-13-7-22(8-14-25)28(35)17-6-20-4-11-24(31)12-5-20/h2-19H,1H3,(H,32,33,34)/b17-6+ |
| InChIKey | QWCQCBWRUUSTNW-UBKPWBPPSA-N |
| XLogP | 7.60 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|