C24H23N5O — CID 10982194
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine (PubChem CID 10982194) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 10982194 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine |
| SMILES | COc1ccc(-c2cc3cccnc3nc2N/N=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H23N5O/c1-29(2)20-10-6-17(7-11-20)16-26-28-24-22(18-8-12-21(30-3)13-9-18)15-19-5-4-14-25-23(19)27-24/h4-16H,1-3H3,(H,25,27,28)/b26-16+ |
| InChIKey | LAYZKDGUYXAFSG-WGOQTCKBSA-N |
| XLogP | 4.82 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|