C24H22N4O3 — CID 10960641
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine (PubChem CID 10960641) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 10960641 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methoxyphenyl)-1,8-naphthyridin-2-amine |
| SMILES | COc1ccc(-c2cc3cccnc3nc2N/N=C/c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-29-19-9-7-17(8-10-19)20-14-18-5-4-12-25-23(18)27-24(20)28-26-15-16-6-11-21(30-2)22(13-16)31-3/h4-15H,1-3H3,(H,25,27,28)/b26-15+ |
| InChIKey | UVGCPIAHOIRPCN-CVKSISIWSA-N |
| XLogP | 4.77 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|