C22H15ClN4O2 — CID 11463797
N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-chlorophenyl)-1,8-naphthyridin-2-amine (PubChem CID 11463797) has the molecular formula C22H15ClN4O2 and a molecular weight of 402.84 g/mol. Its IUPAC name is N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-chlorophenyl)-1,8-naphthyridin-2-amine.
| Compound Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-chlorophenyl)-1,8-naphthyridin-2-amine |
|---|---|
| PubChem CID | 11463797 |
| Molecular Formula | C22H15ClN4O2 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-3-(4-chlorophenyl)-1,8-naphthyridin-2-amine |
| SMILES | Clc1ccc(-c2cc3cccnc3nc2N/N=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H15ClN4O2/c23-17-6-4-15(5-7-17)18-11-16-2-1-9-24-21(16)26-22(18)27-25-12-14-3-8-19-20(10-14)29-13-28-19/h1-12H,13H2,(H,24,26,27)/b25-12+ |
| InChIKey | SAZMRJJGJLDBQV-BRJLIKDPSA-N |
| XLogP | 5.12 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|