C28H50O5 — CID 10895932
ethyl 3-[(2R,3S)-3-[2-[(4R,5R)-2,2-dimethyl-5-[(Z)-tetradec-3-enyl]-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate (PubChem CID 10895932) has the molecular formula C28H50O5 and a molecular weight of 466.70 g/mol. Its IUPAC name is ethyl 3-[(2R,3S)-3-[2-[(4R,5R)-2,2-dimethyl-5-[(Z)-tetradec-3-enyl]-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate.
| Compound Name | ethyl 3-[(2R,3S)-3-[2-[(4R,5R)-2,2-dimethyl-5-[(Z)-tetradec-3-enyl]-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 10895932 |
| Molecular Formula | C28H50O5 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | ethyl 3-[(2R,3S)-3-[2-[(4R,5R)-2,2-dimethyl-5-[(Z)-tetradec-3-enyl]-1,3-dioxolan-4-yl]ethyl]oxiran-2-yl]propanoate |
| SMILES | CCCCCCCCCC/C=C\CC[C@H]1OC(C)(C)O[C@@H]1CC[C@@H]1O[C@@H]1CCC(=O)OCC |
| InChI | InChI=1S/C28H50O5/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-25-26(33-28(3,4)32-25)20-19-23-24(31-23)21-22-27(29)30-6-2/h15-16,23-26H,5-14,17-22H2,1-4H3/b16-15-/t23-,24+,25+,26+/m0/s1 |
| InChIKey | CSZNAVSNYRPOGV-NQGCTNJQSA-N |
| XLogP | 7.26 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|