About N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide
N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide (PubChem CID 108959951) has the molecular formula C22H26N2O3
and a molecular weight of 366.46 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide.
Molecular Properties
| Compound Name | N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide |
| PubChem CID | 108959951 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide |
| SMILES | CC(C)(C(=O)N1CCOCC1)C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O3/c1-22(2,20(25)23-13-15-27-16-14-23)21(26)24(19-11-7-4-8-12-19)17-18-9-5-3-6-10-18/h3-12H,13-17H2,1-2H3 |
| InChIKey | FPLXYAQJCAZOFL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide?
The IUPAC name of N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide (CID 108959951) is N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide.
What is the SMILES notation for N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide?
The canonical SMILES for N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide is CC(C)(C(=O)N1CCOCC1)C(=O)N(Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide?
The InChIKey is FPLXYAQJCAZOFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2O3/c1-22(2,20(25)23-13-15-27-16-14-23)21(26)24(19-11-7-4-8-12-19)17-18-9-5-3-6-10-18/h3-12H,13-17H2,1-2H3.
What are the key properties of N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide?
N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide has a molecular weight of 366.46 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,2-dimethyl-3-morpholin-4-yl-3-oxo-N-phenylpropanamide is sourced from PubChem (CID 108959951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).