C23H43IO2Si — CID 10896441
(1R)-1-[(1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-(iodomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methylhex-4-en-1-ol (PubChem CID 10896441) has the molecular formula C23H43IO2Si and a molecular weight of 506.59 g/mol. Its IUPAC name is (1R)-1-[(1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-(iodomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methylhex-4-en-1-ol.
| Compound Name | (1R)-1-[(1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-(iodomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methylhex-4-en-1-ol |
|---|---|
| PubChem CID | 10896441 |
| Molecular Formula | C23H43IO2Si |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (1R)-1-[(1S,3aR,4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-(iodomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-5-methylhex-4-en-1-ol |
| SMILES | CC(C)=CCC[C@@H](O)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12CI |
| InChI | InChI=1S/C23H43IO2Si/c1-17(2)10-8-11-20(25)18-13-14-19-21(12-9-15-23(18,19)16-24)26-27(6,7)22(3,4)5/h10,18-21,25H,8-9,11-16H2,1-7H3/t18-,19+,20-,21+,23+/m1/s1 |
| InChIKey | IAWFVNSHIKOKLF-YBNCXLCVSA-N |
| XLogP | 7.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|