C32H68O5Si3 — CID 10897396
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]butanal (PubChem CID 10897396) has the molecular formula C32H68O5Si3 and a molecular weight of 617.15 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]butanal.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]butanal |
|---|---|
| PubChem CID | 10897396 |
| Molecular Formula | C32H68O5Si3 |
| Molecular Weight | 617.15 g/mol |
| Exact Mass | 616.44 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4R,6S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]butanal |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](C[C@H](CC=O)O[Si](C)(C)C(C)(C)C)O[C@@H](CCO[Si](C)(C)C(C)(C)C)C1)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H68O5Si3/c1-24(2)40(25(3)4,26(5)6)37-30-21-27(18-20-34-38(13,14)31(7,8)9)35-29(23-30)22-28(17-19-33)36-39(15,16)32(10,11)12/h19,24-30H,17-18,20-23H2,1-16H3/t27-,28-,29-,30+/m0/s1 |
| InChIKey | USEIJDUMOPKFJJ-GCXHJFECSA-N |
| XLogP | 9.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.15 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|