C16H24Cl2N2O — CID 109006595
N-[2-(2,4-dichlorophenyl)ethyl]-2-(dipropylamino)acetamide (PubChem CID 109006595) has the molecular formula C16H24Cl2N2O and a molecular weight of 331.29 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2-(dipropylamino)acetamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(dipropylamino)acetamide |
|---|---|
| PubChem CID | 109006595 |
| Molecular Formula | C16H24Cl2N2O |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2-(dipropylamino)acetamide |
| SMILES | CCCN(CCC)CC(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2N2O/c1-3-9-20(10-4-2)12-16(21)19-8-7-13-5-6-14(17)11-15(13)18/h5-6,11H,3-4,7-10,12H2,1-2H3,(H,19,21) |
| InChIKey | KKSZRIYRHBFJRJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |