C14H22O3Si — CID 10901557
(1R,3R)-1-[(2R)-2-[dimethyl(phenyl)silyl]oxiran-2-yl]butane-1,3-diol (PubChem CID 10901557) has the molecular formula C14H22O3Si and a molecular weight of 266.41 g/mol. Its IUPAC name is (1R,3R)-1-[(2R)-2-[dimethyl(phenyl)silyl]oxiran-2-yl]butane-1,3-diol.
| Compound Name | (1R,3R)-1-[(2R)-2-[dimethyl(phenyl)silyl]oxiran-2-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 10901557 |
| Molecular Formula | C14H22O3Si |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1R,3R)-1-[(2R)-2-[dimethyl(phenyl)silyl]oxiran-2-yl]butane-1,3-diol |
| SMILES | C[C@@H](O)C[C@@H](O)[C@]1([Si](C)(C)c2ccccc2)CO1 |
| InChI | InChI=1S/C14H22O3Si/c1-11(15)9-13(16)14(10-17-14)18(2,3)12-7-5-4-6-8-12/h4-8,11,13,15-16H,9-10H2,1-3H3/t11-,13-,14-/m1/s1 |
| InChIKey | UMNGFQSYWBATEQ-MRVWCRGKSA-N |
| XLogP | 1.04 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|