C28H37PSSi3 — CID 177466379
[2,2-bis[dimethyl(phenyl)silyl]-6-thia-1-phosphabicyclo[3.1.0]hexan-5-yl]-dimethyl-phenylsilane (PubChem CID 177466379) has the molecular formula C28H37PSSi3 and a molecular weight of 520.90 g/mol. Its IUPAC name is [2,2-bis[dimethyl(phenyl)silyl]-6-thia-1-phosphabicyclo[3.1.0]hexan-5-yl]-dimethyl-phenylsilane.
| Compound Name | [2,2-bis[dimethyl(phenyl)silyl]-6-thia-1-phosphabicyclo[3.1.0]hexan-5-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 177466379 |
| Molecular Formula | C28H37PSSi3 |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [2,2-bis[dimethyl(phenyl)silyl]-6-thia-1-phosphabicyclo[3.1.0]hexan-5-yl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)C12CCC([Si](C)(C)c3ccccc3)([Si](C)(C)c3ccccc3)P1S2 |
| InChI | InChI=1S/C28H37PSSi3/c1-31(2,24-16-10-7-11-17-24)27-22-23-28(29(27)30-27,32(3,4)25-18-12-8-13-19-25)33(5,6)26-20-14-9-15-21-26/h7-21H,22-23H2,1-6H3 |
| InChIKey | FXZQNTSEOOTPSZ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|