C23H32SSi2 — CID 122369555
[6-[dimethyl(phenyl)silyl]-3,4-dimethyl-2,5-dihydrothiopyran-6-yl]-dimethyl-phenylsilane (PubChem CID 122369555) has the molecular formula C23H32SSi2 and a molecular weight of 396.75 g/mol. Its IUPAC name is [6-[dimethyl(phenyl)silyl]-3,4-dimethyl-2,5-dihydrothiopyran-6-yl]-dimethyl-phenylsilane.
| Compound Name | [6-[dimethyl(phenyl)silyl]-3,4-dimethyl-2,5-dihydrothiopyran-6-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 122369555 |
| Molecular Formula | C23H32SSi2 |
| Molecular Weight | 396.75 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [6-[dimethyl(phenyl)silyl]-3,4-dimethyl-2,5-dihydrothiopyran-6-yl]-dimethyl-phenylsilane |
| SMILES | CC1=C(C)CC([Si](C)(C)c2ccccc2)([Si](C)(C)c2ccccc2)SC1 |
| InChI | InChI=1S/C23H32SSi2/c1-19-17-23(24-18-20(19)2,25(3,4)21-13-9-7-10-14-21)26(5,6)22-15-11-8-12-16-22/h7-16H,17-18H2,1-6H3 |
| InChIKey | QXEPBNNVTYSERV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.75 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|