C23H42OSi3 — CID 102048786
[(1R,6R)-1-tert-butyl-3,4-dimethyl-6-phenyl-1-trimethylsilyl-2,5-dihydrosilin-6-yl]oxy-trimethylsilane (PubChem CID 102048786) has the molecular formula C23H42OSi3 and a molecular weight of 418.85 g/mol. Its IUPAC name is [(1R,6R)-1-tert-butyl-3,4-dimethyl-6-phenyl-1-trimethylsilyl-2,5-dihydrosilin-6-yl]oxy-trimethylsilane.
| Compound Name | [(1R,6R)-1-tert-butyl-3,4-dimethyl-6-phenyl-1-trimethylsilyl-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 102048786 |
| Molecular Formula | C23H42OSi3 |
| Molecular Weight | 418.85 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | [(1R,6R)-1-tert-butyl-3,4-dimethyl-6-phenyl-1-trimethylsilyl-2,5-dihydrosilin-6-yl]oxy-trimethylsilane |
| SMILES | CC1=C(C)C[Si@](C(C)(C)C)([Si](C)(C)C)[C@@](O[Si](C)(C)C)(c2ccccc2)C1 |
| InChI | InChI=1S/C23H42OSi3/c1-19-17-23(24-25(6,7)8,21-15-13-12-14-16-21)27(18-20(19)2,22(3,4)5)26(9,10)11/h12-16H,17-18H2,1-11H3/t23-,27-/m1/s1 |
| InChIKey | OXZLIPVFNSCLRM-YIXXDRMTSA-N |
| XLogP | 7.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.85 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|