C23H45NOSi4 — CID 101178415
(1S,6R)-N,3,4-trimethyl-N-phenyl-1,6-bis(trimethylsilyl)-1-trimethylsilyloxy-2,5-dihydrosilin-6-amine (PubChem CID 101178415) has the molecular formula C23H45NOSi4 and a molecular weight of 463.96 g/mol. Its IUPAC name is (1S,6R)-N,3,4-trimethyl-N-phenyl-1,6-bis(trimethylsilyl)-1-trimethylsilyloxy-2,5-dihydrosilin-6-amine.
| Compound Name | (1S,6R)-N,3,4-trimethyl-N-phenyl-1,6-bis(trimethylsilyl)-1-trimethylsilyloxy-2,5-dihydrosilin-6-amine |
|---|---|
| PubChem CID | 101178415 |
| Molecular Formula | C23H45NOSi4 |
| Molecular Weight | 463.96 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (1S,6R)-N,3,4-trimethyl-N-phenyl-1,6-bis(trimethylsilyl)-1-trimethylsilyloxy-2,5-dihydrosilin-6-amine |
| SMILES | CC1=C(C)C[Si@](O[Si](C)(C)C)([Si](C)(C)C)[C@](N(C)c2ccccc2)([Si](C)(C)C)C1 |
| InChI | InChI=1S/C23H45NOSi4/c1-20-18-23(26(4,5)6,24(3)22-16-14-13-15-17-22)29(19-21(20)2,28(10,11)12)25-27(7,8)9/h13-17H,18-19H2,1-12H3/t23-,29+/m1/s1 |
| InChIKey | HCLVEFPNNYHAEE-BTYSJIOQSA-N |
| XLogP | 7.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.96 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|