C21H38OSi4 — CID 10862679
trimethyl-[[(1S,3R,4R)-3-phenyl-2,2-bis(trimethylsilyl)-2-silabicyclo[2.2.1]hept-5-en-3-yl]oxy]silane (PubChem CID 10862679) has the molecular formula C21H38OSi4 and a molecular weight of 418.88 g/mol. Its IUPAC name is trimethyl-[[(1S,3R,4R)-3-phenyl-2,2-bis(trimethylsilyl)-2-silabicyclo[2.2.1]hept-5-en-3-yl]oxy]silane.
| Compound Name | trimethyl-[[(1S,3R,4R)-3-phenyl-2,2-bis(trimethylsilyl)-2-silabicyclo[2.2.1]hept-5-en-3-yl]oxy]silane |
|---|---|
| PubChem CID | 10862679 |
| Molecular Formula | C21H38OSi4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | trimethyl-[[(1S,3R,4R)-3-phenyl-2,2-bis(trimethylsilyl)-2-silabicyclo[2.2.1]hept-5-en-3-yl]oxy]silane |
| SMILES | C[Si](C)(C)O[C@]1(c2ccccc2)[C@H]2C=C[C@H](C2)[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C21H38OSi4/c1-23(2,3)22-21(18-13-11-10-12-14-18)19-15-16-20(17-19)26(21,24(4,5)6)25(7,8)9/h10-16,19-20H,17H2,1-9H3/t19-,20+,21-/m0/s1 |
| InChIKey | LDUPUNQSONBXTD-HBMCJLEFSA-N |
| XLogP | 6.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|