C17H20O3 — CID 10901734
3-(1-hydroxy-1-phenylethyl)-4-pentylcyclobut-3-ene-1,2-dione (PubChem CID 10901734) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-(1-hydroxy-1-phenylethyl)-4-pentylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1-hydroxy-1-phenylethyl)-4-pentylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10901734 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-(1-hydroxy-1-phenylethyl)-4-pentylcyclobut-3-ene-1,2-dione |
| SMILES | CCCCCc1c(C(C)(O)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C17H20O3/c1-3-4-6-11-13-14(16(19)15(13)18)17(2,20)12-9-7-5-8-10-12/h5,7-10,20H,3-4,6,11H2,1-2H3 |
| InChIKey | ZOCZXEXKGCEXSP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|