C18H29NO2Si — CID 10903266
methyl (2R,3R)-2-amino-4-[dimethyl(phenyl)silyl]-3-methyl-2-propan-2-ylpent-4-enoate (PubChem CID 10903266) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is methyl (2R,3R)-2-amino-4-[dimethyl(phenyl)silyl]-3-methyl-2-propan-2-ylpent-4-enoate.
| Compound Name | methyl (2R,3R)-2-amino-4-[dimethyl(phenyl)silyl]-3-methyl-2-propan-2-ylpent-4-enoate |
|---|---|
| PubChem CID | 10903266 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | methyl (2R,3R)-2-amino-4-[dimethyl(phenyl)silyl]-3-methyl-2-propan-2-ylpent-4-enoate |
| SMILES | C=C([C@H](C)[C@@](N)(C(=O)OC)C(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO2Si/c1-13(2)18(19,17(20)21-5)14(3)15(4)22(6,7)16-11-9-8-10-12-16/h8-14H,4,19H2,1-3,5-7H3/t14-,18+/m0/s1 |
| InChIKey | DBXWHEXBLAAXLT-KBXCAEBGSA-N |
| XLogP | 2.86 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|