C20H28O7 — CID 10904996
(1R)-1-[(3aR,5R,6R,6aR)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol (PubChem CID 10904996) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is (1R)-1-[(3aR,5R,6R,6aR)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3aR,5R,6R,6aR)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 10904996 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (1R)-1-[(3aR,5R,6R,6aR)-6-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethane-1,2-diol |
| SMILES | C=CC[C@@]1(OCc2ccc(OC)cc2)[C@@H]([C@H](O)CO)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H28O7/c1-5-10-20(24-12-13-6-8-14(23-4)9-7-13)16(15(22)11-21)25-18-17(20)26-19(2,3)27-18/h5-9,15-18,21-22H,1,10-12H2,2-4H3/t15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | XWXMBQQRAQDEIX-BFMVXSJESA-N |
| XLogP | 1.76 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|