C21H22O9 — CID 10905855
(E)-1-[2-hydroxy-3-methoxy-4-(methoxymethoxy)phenyl]-3-[6-(methoxymethoxy)-1,3-benzodioxol-5-yl]prop-2-en-1-one (PubChem CID 10905855) has the molecular formula C21H22O9 and a molecular weight of 418.40 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-3-methoxy-4-(methoxymethoxy)phenyl]-3-[6-(methoxymethoxy)-1,3-benzodioxol-5-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-3-methoxy-4-(methoxymethoxy)phenyl]-3-[6-(methoxymethoxy)-1,3-benzodioxol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 10905855 |
| Molecular Formula | C21H22O9 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (E)-1-[2-hydroxy-3-methoxy-4-(methoxymethoxy)phenyl]-3-[6-(methoxymethoxy)-1,3-benzodioxol-5-yl]prop-2-en-1-one |
| SMILES | COCOc1cc2c(cc1/C=C/C(=O)c1ccc(OCOC)c(OC)c1O)OCO2 |
| InChI | InChI=1S/C21H22O9/c1-24-10-27-16-7-5-14(20(23)21(16)26-3)15(22)6-4-13-8-18-19(30-12-29-18)9-17(13)28-11-25-2/h4-9,23H,10-12H2,1-3H3/b6-4+ |
| InChIKey | OWQPJYHIBKUQNS-GQCTYLIASA-N |
| XLogP | 2.99 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|