C28H27FN2O — CID 10906044
2-[(Z)-(9-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ylidene)methyl]-N,N-dimethylaniline (PubChem CID 10906044) has the molecular formula C28H27FN2O and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[(Z)-(9-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ylidene)methyl]-N,N-dimethylaniline.
| Compound Name | 2-[(Z)-(9-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ylidene)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 10906044 |
| Molecular Formula | C28H27FN2O |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[(Z)-(9-fluoro-2,2,4-trimethyl-1H-chromeno[3,4-f]quinolin-5-ylidene)methyl]-N,N-dimethylaniline |
| SMILES | CC1=CC(C)(C)Nc2ccc3c(c21)/C(=C/c1ccccc1N(C)C)Oc1ccc(F)cc1-3 |
| InChI | InChI=1S/C28H27FN2O/c1-17-16-28(2,3)30-22-12-11-20-21-15-19(29)10-13-24(21)32-25(27(20)26(17)22)14-18-8-6-7-9-23(18)31(4)5/h6-16,30H,1-5H3/b25-14- |
| InChIKey | CWXNSHLNBNLSSS-QFEZKATASA-N |
| XLogP | 7.06 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|