C17H16N4O4S — CID 109060863
4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 109060863) has the molecular formula C17H16N4O4S and a molecular weight of 372.41 g/mol. Its IUPAC name is 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 109060863 |
| Molecular Formula | C17H16N4O4S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-[(5-methyl-1,2-oxazol-3-yl)sulfamoyl]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(C(=O)NCc3ccccn3)cc2)no1 |
| InChI | InChI=1S/C17H16N4O4S/c1-12-10-16(20-25-12)21-26(23,24)15-7-5-13(6-8-15)17(22)19-11-14-4-2-3-9-18-14/h2-10H,11H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | BFEZHYFVZPMZAI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |