C25H22FNO5S — CID 10906747
methyl (4S,5R)-5-[2-fluoro-3,4-bis(phenylmethoxy)phenyl]-2-sulfanylidene-1,3-oxazolidine-4-carboxylate (PubChem CID 10906747) has the molecular formula C25H22FNO5S and a molecular weight of 467.52 g/mol. Its IUPAC name is methyl (4S,5R)-5-[2-fluoro-3,4-bis(phenylmethoxy)phenyl]-2-sulfanylidene-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[2-fluoro-3,4-bis(phenylmethoxy)phenyl]-2-sulfanylidene-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10906747 |
| Molecular Formula | C25H22FNO5S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | methyl (4S,5R)-5-[2-fluoro-3,4-bis(phenylmethoxy)phenyl]-2-sulfanylidene-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@H]1NC(=S)O[C@@H]1c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1F |
| InChI | InChI=1S/C25H22FNO5S/c1-29-24(28)21-22(32-25(33)27-21)18-12-13-19(30-14-16-8-4-2-5-9-16)23(20(18)26)31-15-17-10-6-3-7-11-17/h2-13,21-22H,14-15H2,1H3,(H,27,33)/t21-,22+/m0/s1 |
| InChIKey | SUKOOYJSJVANMT-FCHUYYIVSA-N |
| XLogP | 4.47 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|