C24H50O5Si2 — CID 10906862
(2S,3R,4S,5R)-3,5-dihydroxy-2,4-bis[tri(propan-2-yl)silyloxy]cyclohexan-1-one (PubChem CID 10906862) has the molecular formula C24H50O5Si2 and a molecular weight of 474.83 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3,5-dihydroxy-2,4-bis[tri(propan-2-yl)silyloxy]cyclohexan-1-one.
| Compound Name | (2S,3R,4S,5R)-3,5-dihydroxy-2,4-bis[tri(propan-2-yl)silyloxy]cyclohexan-1-one |
|---|---|
| PubChem CID | 10906862 |
| Molecular Formula | C24H50O5Si2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (2S,3R,4S,5R)-3,5-dihydroxy-2,4-bis[tri(propan-2-yl)silyloxy]cyclohexan-1-one |
| SMILES | CC(C)[Si](O[C@@H]1[C@@H](O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C(=O)C[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H50O5Si2/c1-14(2)30(15(3)4,16(5)6)28-23-20(25)13-21(26)24(22(23)27)29-31(17(7)8,18(9)10)19(11)12/h14-20,22-25,27H,13H2,1-12H3/t20-,22-,23+,24-/m1/s1 |
| InChIKey | KHBCBYZUOSWJPR-CAUSLRQDSA-N |
| XLogP | 5.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|