C26H37O8P — CID 10907328
(3R)-1-bis(phenylmethoxy)phosphoryl-3,4-bis(1-ethoxyethoxy)butan-2-one (PubChem CID 10907328) has the molecular formula C26H37O8P and a molecular weight of 508.55 g/mol. Its IUPAC name is (3R)-1-bis(phenylmethoxy)phosphoryl-3,4-bis(1-ethoxyethoxy)butan-2-one.
| Compound Name | (3R)-1-bis(phenylmethoxy)phosphoryl-3,4-bis(1-ethoxyethoxy)butan-2-one |
|---|---|
| PubChem CID | 10907328 |
| Molecular Formula | C26H37O8P |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | (3R)-1-bis(phenylmethoxy)phosphoryl-3,4-bis(1-ethoxyethoxy)butan-2-one |
| SMILES | CCOC(C)OC[C@@H](OC(C)OCC)C(=O)CP(=O)(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C26H37O8P/c1-5-29-21(3)31-19-26(34-22(4)30-6-2)25(27)20-35(28,32-17-23-13-9-7-10-14-23)33-18-24-15-11-8-12-16-24/h7-16,21-22,26H,5-6,17-20H2,1-4H3/t21?,22?,26-/m1/s1 |
| InChIKey | ZVDQOKCQAGROHT-AJEPASEPSA-N |
| XLogP | 5.35 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|