C31H58O5Si — CID 10907632
(E,2R,3S,4R,6R)-2-[(4R,5R,6R)-2,2-ditert-butyl-5-methyl-6-[(2S)-3-oxopentan-2-yl]-1,3,2-dioxasilinan-4-yl]-3-hydroxy-4,6,8-trimethylundec-8-en-5-one (PubChem CID 10907632) has the molecular formula C31H58O5Si and a molecular weight of 538.89 g/mol. Its IUPAC name is (E,2R,3S,4R,6R)-2-[(4R,5R,6R)-2,2-ditert-butyl-5-methyl-6-[(2S)-3-oxopentan-2-yl]-1,3,2-dioxasilinan-4-yl]-3-hydroxy-4,6,8-trimethylundec-8-en-5-one.
| Compound Name | (E,2R,3S,4R,6R)-2-[(4R,5R,6R)-2,2-ditert-butyl-5-methyl-6-[(2S)-3-oxopentan-2-yl]-1,3,2-dioxasilinan-4-yl]-3-hydroxy-4,6,8-trimethylundec-8-en-5-one |
|---|---|
| PubChem CID | 10907632 |
| Molecular Formula | C31H58O5Si |
| Molecular Weight | 538.89 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | (E,2R,3S,4R,6R)-2-[(4R,5R,6R)-2,2-ditert-butyl-5-methyl-6-[(2S)-3-oxopentan-2-yl]-1,3,2-dioxasilinan-4-yl]-3-hydroxy-4,6,8-trimethylundec-8-en-5-one |
| SMILES | CC/C=C(\C)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)[C@H]1O[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]([C@H](C)C(=O)CC)[C@@H]1C |
| InChI | InChI=1S/C31H58O5Si/c1-15-17-19(3)18-20(4)26(33)22(6)27(34)23(7)29-24(8)28(21(5)25(32)16-2)35-37(36-29,30(9,10)11)31(12,13)14/h17,20-24,27-29,34H,15-16,18H2,1-14H3/b19-17+/t20-,21-,22+,23-,24+,27-,28+,29-/m1/s1 |
| InChIKey | ZTEUIGGWJGLVGY-JDSZWMJOSA-N |
| XLogP | 7.65 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.89 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|