C21H25FN4O2 — CID 109106695
N-tert-butyl-5-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyridine-3-carboxamide (PubChem CID 109106695) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is N-tert-butyl-5-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyridine-3-carboxamide.
| Compound Name | N-tert-butyl-5-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109106695 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-tert-butyl-5-[4-(2-fluorophenyl)piperazine-1-carbonyl]pyridine-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cncc(C(=O)N2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C21H25FN4O2/c1-21(2,3)24-19(27)15-12-16(14-23-13-15)20(28)26-10-8-25(9-11-26)18-7-5-4-6-17(18)22/h4-7,12-14H,8-11H2,1-3H3,(H,24,27) |
| InChIKey | QXTKYRXYAWADHF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |