C20H26FN5O — CID 109229318
[5-[2-(dimethylamino)ethylamino]-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 109229318) has the molecular formula C20H26FN5O and a molecular weight of 371.46 g/mol. Its IUPAC name is [5-[2-(dimethylamino)ethylamino]-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | [5-[2-(dimethylamino)ethylamino]-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 109229318 |
| Molecular Formula | C20H26FN5O |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [5-[2-(dimethylamino)ethylamino]-3-pyridinyl]-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | CN(C)CCNc1cncc(C(=O)N2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C20H26FN5O/c1-24(2)8-7-23-17-13-16(14-22-15-17)20(27)26-11-9-25(10-12-26)19-6-4-3-5-18(19)21/h3-6,13-15,23H,7-12H2,1-2H3 |
| InChIKey | WJYHZPKRDAAKAP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |