C22H27FN4O2 — CID 109106697
5-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N-pentylpyridine-3-carboxamide (PubChem CID 109106697) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 5-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N-pentylpyridine-3-carboxamide.
| Compound Name | 5-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N-pentylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109106697 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 5-[4-(2-fluorophenyl)piperazine-1-carbonyl]-N-pentylpyridine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1cncc(C(=O)N2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C22H27FN4O2/c1-2-3-6-9-25-21(28)17-14-18(16-24-15-17)22(29)27-12-10-26(11-13-27)20-8-5-4-7-19(20)23/h4-5,7-8,14-16H,2-3,6,9-13H2,1H3,(H,25,28) |
| InChIKey | OLYZGYATLQYFCV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|