C21H26FN5O — CID 109230282
[4-(2-fluorophenyl)piperazin-1-yl]-[5-(4-methylpiperazin-1-yl)-3-pyridinyl]methanone (PubChem CID 109230282) has the molecular formula C21H26FN5O and a molecular weight of 383.47 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-[5-(4-methylpiperazin-1-yl)-3-pyridinyl]methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-[5-(4-methylpiperazin-1-yl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109230282 |
| Molecular Formula | C21H26FN5O |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-[5-(4-methylpiperazin-1-yl)-3-pyridinyl]methanone |
| SMILES | CN1CCN(c2cncc(C(=O)N3CCN(c4ccccc4F)CC3)c2)CC1 |
| InChI | InChI=1S/C21H26FN5O/c1-24-6-8-25(9-7-24)18-14-17(15-23-16-18)21(28)27-12-10-26(11-13-27)20-5-3-2-4-19(20)22/h2-5,14-16H,6-13H2,1H3 |
| InChIKey | MYQQLNRZYZYVKP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |