C14H24O — CID 10910766
(1S,3aS,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroindene (PubChem CID 10910766) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (1S,3aS,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroindene.
| Compound Name | (1S,3aS,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroindene |
|---|---|
| PubChem CID | 10910766 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (1S,3aS,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroindene |
| SMILES | CC(C)(C)O[C@H]1CC[C@H]2C=CCC[C@@]21C |
| InChI | InChI=1S/C14H24O/c1-13(2,3)15-12-9-8-11-7-5-6-10-14(11,12)4/h5,7,11-12H,6,8-10H2,1-4H3/t11-,12+,14+/m1/s1 |
| InChIKey | UCPZKQNJRJRNJK-DYEKYZERSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|