C21H30O3 — CID 10914512
(2R)-2-[(2S,3S,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]oxan-2-yl]pent-3-yn-2-ol (PubChem CID 10914512) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (2R)-2-[(2S,3S,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]oxan-2-yl]pent-3-yn-2-ol.
| Compound Name | (2R)-2-[(2S,3S,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]oxan-2-yl]pent-3-yn-2-ol |
|---|---|
| PubChem CID | 10914512 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (2R)-2-[(2S,3S,6S)-3-methyl-6-[(2R)-1-phenylmethoxypropan-2-yl]oxan-2-yl]pent-3-yn-2-ol |
| SMILES | CC#C[C@@](C)(O)[C@H]1O[C@H]([C@H](C)COCc2ccccc2)CC[C@@H]1C |
| InChI | InChI=1S/C21H30O3/c1-5-13-21(4,22)20-16(2)11-12-19(24-20)17(3)14-23-15-18-9-7-6-8-10-18/h6-10,16-17,19-20,22H,11-12,14-15H2,1-4H3/t16-,17+,19-,20-,21+/m0/s1 |
| InChIKey | JOTSJADKRUODHG-YZUZWNONSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|