C23H34O2 — CID 11089163
(2S,3S,6S)-3-methyl-2-[(2E,4S)-4-methylhexa-2,5-dien-2-yl]-6-[(2R)-1-phenylmethoxypropan-2-yl]oxane (PubChem CID 11089163) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is (2S,3S,6S)-3-methyl-2-[(2E,4S)-4-methylhexa-2,5-dien-2-yl]-6-[(2R)-1-phenylmethoxypropan-2-yl]oxane.
| Compound Name | (2S,3S,6S)-3-methyl-2-[(2E,4S)-4-methylhexa-2,5-dien-2-yl]-6-[(2R)-1-phenylmethoxypropan-2-yl]oxane |
|---|---|
| PubChem CID | 11089163 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | (2S,3S,6S)-3-methyl-2-[(2E,4S)-4-methylhexa-2,5-dien-2-yl]-6-[(2R)-1-phenylmethoxypropan-2-yl]oxane |
| SMILES | C=C[C@H](C)/C=C(\C)[C@H]1O[C@H]([C@H](C)COCc2ccccc2)CC[C@@H]1C |
| InChI | InChI=1S/C23H34O2/c1-6-17(2)14-19(4)23-18(3)12-13-22(25-23)20(5)15-24-16-21-10-8-7-9-11-21/h6-11,14,17-18,20,22-23H,1,12-13,15-16H2,2-5H3/b19-14+/t17-,18-,20+,22-,23-/m0/s1 |
| InChIKey | JJPYRZJHRXPEMV-AZTICXNFSA-N |
| XLogP | 5.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|