C19H32O3Si — CID 10914676
[(2S,7R)-2,7-bis(prop-2-enoxy)cyclohepta-3,5-dien-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10914676) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is [(2S,7R)-2,7-bis(prop-2-enoxy)cyclohepta-3,5-dien-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,7R)-2,7-bis(prop-2-enoxy)cyclohepta-3,5-dien-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10914676 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | [(2S,7R)-2,7-bis(prop-2-enoxy)cyclohepta-3,5-dien-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCO[C@H]1C=CC=C[C@@H](OCC=C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O3Si/c1-8-14-20-16-12-10-11-13-17(21-15-9-2)18(16)22-23(6,7)19(3,4)5/h8-13,16-18H,1-2,14-15H2,3-7H3/t16-,17+,18? |
| InChIKey | ANYZONARMCVTPG-JWTNVVGKSA-N |
| XLogP | 4.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|