C18H28O6 — CID 10914771
methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(acetyloxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate (PubChem CID 10914771) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(acetyloxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate.
| Compound Name | methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(acetyloxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate |
|---|---|
| PubChem CID | 10914771 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | methyl (2S)-2-[(2R,2aR,4aS,7R,8aR)-2-(acetyloxymethyl)-2a,4a-dimethyl-2,4,5,6,7,8-hexahydrooxeto[2,3-i][2]benzofuran-7-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@H]1CC[C@@]2(C)CO[C@]3(C)[C@@H](COC(C)=O)O[C@]23C1 |
| InChI | InChI=1S/C18H28O6/c1-11(15(20)21-5)13-6-7-16(3)10-23-17(4)14(9-22-12(2)19)24-18(16,17)8-13/h11,13-14H,6-10H2,1-5H3/t11-,13+,14+,16-,17+,18+/m0/s1 |
| InChIKey | BSHBDBOOJXIMST-ILGLWPRSSA-N |
| XLogP | 2.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |