C16H30O6Si — CID 10914973
(4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one (PubChem CID 10914973) has the molecular formula C16H30O6Si and a molecular weight of 346.50 g/mol. Its IUPAC name is (4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one.
| Compound Name | (4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10914973 |
| Molecular Formula | C16H30O6Si |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-one |
| SMILES | COCO[C@H]1C=C(CO[Si](C)(C)C(C)(C)C)C(=O)[C@@H]1OCOC |
| InChI | InChI=1S/C16H30O6Si/c1-16(2,3)23(6,7)22-9-12-8-13(20-10-18-4)15(14(12)17)21-11-19-5/h8,13,15H,9-11H2,1-7H3/t13-,15+/m0/s1 |
| InChIKey | XILPWYFGXZEAQP-DZGCQCFKSA-N |
| XLogP | 2.50 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|