C14H26N2O5S2 — CID 10915538
1,4,13-trioxa-10,16-dithia-7,19-diazacyclohenicosane-8,18-dione (PubChem CID 10915538) has the molecular formula C14H26N2O5S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1,4,13-trioxa-10,16-dithia-7,19-diazacyclohenicosane-8,18-dione.
| Compound Name | 1,4,13-trioxa-10,16-dithia-7,19-diazacyclohenicosane-8,18-dione |
|---|---|
| PubChem CID | 10915538 |
| Molecular Formula | C14H26N2O5S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1,4,13-trioxa-10,16-dithia-7,19-diazacyclohenicosane-8,18-dione |
| SMILES | O=C1CSCCOCCSCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C14H26N2O5S2/c17-13-11-22-9-7-21-8-10-23-12-14(18)16-2-4-20-6-5-19-3-1-15-13/h1-12H2,(H,15,17)(H,16,18) |
| InChIKey | CREFRNFVXXSIQN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |