C16H32N4O5 — CID 10992026
13,16-dimethyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,18-dione (PubChem CID 10992026) has the molecular formula C16H32N4O5 and a molecular weight of 360.46 g/mol. Its IUPAC name is 13,16-dimethyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,18-dione.
| Compound Name | 13,16-dimethyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,18-dione |
|---|---|
| PubChem CID | 10992026 |
| Molecular Formula | C16H32N4O5 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 13,16-dimethyl-1,4,7-trioxa-10,13,16,19-tetrazacyclohenicosane-11,18-dione |
| SMILES | CN1CCN(C)CC(=O)NCCOCCOCCOCCNC(=O)C1 |
| InChI | InChI=1S/C16H32N4O5/c1-19-5-6-20(2)14-16(22)18-4-8-24-10-12-25-11-9-23-7-3-17-15(21)13-19/h3-14H2,1-2H3,(H,17,21)(H,18,22) |
| InChIKey | AKOCTRZEMWZWHC-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |