C41H82N4O15 — CID 102375956
33,53-dihydroxy-35,51-dimethyl-1,4,7,10,13,16,19,22,25,28,31-undecaoxa-35,38,48,51-tetrazacyclotetrapentacontane-37,49-dione (PubChem CID 102375956) has the molecular formula C41H82N4O15 and a molecular weight of 871.12 g/mol. Its IUPAC name is 33,53-dihydroxy-35,51-dimethyl-1,4,7,10,13,16,19,22,25,28,31-undecaoxa-35,38,48,51-tetrazacyclotetrapentacontane-37,49-dione.
| Compound Name | 33,53-dihydroxy-35,51-dimethyl-1,4,7,10,13,16,19,22,25,28,31-undecaoxa-35,38,48,51-tetrazacyclotetrapentacontane-37,49-dione |
|---|---|
| PubChem CID | 102375956 |
| Molecular Formula | C41H82N4O15 |
| Molecular Weight | 871.12 g/mol |
| Exact Mass | 870.58 |
| IUPAC Name | 33,53-dihydroxy-35,51-dimethyl-1,4,7,10,13,16,19,22,25,28,31-undecaoxa-35,38,48,51-tetrazacyclotetrapentacontane-37,49-dione |
| SMILES | CN1CC(=O)NCCCCCCCCCNC(=O)CN(C)CC(O)COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(O)C1 |
| InChI | InChI=1S/C41H82N4O15/c1-44-32-38(46)36-59-30-28-57-26-24-55-22-20-53-18-16-51-14-12-50-13-15-52-17-19-54-21-23-56-25-27-58-29-31-60-37-39(47)33-45(2)35-41(49)43-11-9-7-5-3-4-6-8-10-42-40(48)34-44/h38-39,46-47H,3-37H2,1-2H3,(H,42,48)(H,43,49) |
| InChIKey | QIZZEILYNNXZCG-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 206.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.12 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 17 |