C22H23N3O3 — CID 109156396
N-benzyl-6-(3,4-dimethoxyanilino)-N-methylpyridine-3-carboxamide (PubChem CID 109156396) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-benzyl-6-(3,4-dimethoxyanilino)-N-methylpyridine-3-carboxamide.
| Compound Name | N-benzyl-6-(3,4-dimethoxyanilino)-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109156396 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-benzyl-6-(3,4-dimethoxyanilino)-N-methylpyridine-3-carboxamide |
| SMILES | COc1ccc(Nc2ccc(C(=O)N(C)Cc3ccccc3)cn2)cc1OC |
| InChI | InChI=1S/C22H23N3O3/c1-25(15-16-7-5-4-6-8-16)22(26)17-9-12-21(23-14-17)24-18-10-11-19(27-2)20(13-18)28-3/h4-14H,15H2,1-3H3,(H,23,24) |
| InChIKey | DEXKTYQLWQXHCP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |