methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate

C22H44O2S2 — CID 10916493

IUPACmethyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate
SMILESCOC(=O)CCCCC(SC)C(CCCCCCCCCC(C)C)SC
InChIInChI=1S/C22H44O2S2/c1-19(2)15-11-9-7-6-8-10-12-16-20(25-4)21(26-5)17-13-14-18-22(23)24-3/h19-21H,6-18H2,1-5H3
InChIKeyYTNXIEIJKFRBKJ-UHFFFAOYSA-N
MW404.73 g/mol
LogP7.35
Rot. Bonds18

About methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate

methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate (PubChem CID 10916493) has the molecular formula C22H44O2S2 and a molecular weight of 404.73 g/mol. Its IUPAC name is methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate.

Molecular Properties

Compound Namemethyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate
PubChem CID10916493
Molecular FormulaC22H44O2S2
Molecular Weight404.73 g/mol
Exact Mass404.28
IUPAC Namemethyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate
SMILESCOC(=O)CCCCC(SC)C(CCCCCCCCCC(C)C)SC
InChIInChI=1S/C22H44O2S2/c1-19(2)15-11-9-7-6-8-10-12-16-20(25-4)21(26-5)17-13-14-18-22(23)24-3/h19-21H,6-18H2,1-5H3
InChIKeyYTNXIEIJKFRBKJ-UHFFFAOYSA-N
XLogP7.35
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds18
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500404.73
LogP ≤ 57.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate?
The IUPAC name of methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate (CID 10916493) is methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate.
What is the SMILES notation for methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate?
The canonical SMILES for methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate is COC(=O)CCCCC(SC)C(CCCCCCCCCC(C)C)SC.
What is the InChIKey of methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate?
The InChIKey is YTNXIEIJKFRBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2S2/c1-19(2)15-11-9-7-6-8-10-12-16-20(25-4)21(26-5)17-13-14-18-22(23)24-3/h19-21H,6-18H2,1-5H3.
What are the key properties of methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate?
methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate has a molecular weight of 404.73 g/mol, XLogP of 7.35, 18 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 17-methyl-6,7-bis(methylsulfanyl)octadecanoate is sourced from PubChem (CID 10916493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).