C25H38O5 — CID 10916764
methyl (1S,9R,10R,12S)-9-(3,3-diethoxypropyl)-9,12-dimethyl-10-prop-1-en-2-yl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene-5-carboxylate (PubChem CID 10916764) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is methyl (1S,9R,10R,12S)-9-(3,3-diethoxypropyl)-9,12-dimethyl-10-prop-1-en-2-yl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene-5-carboxylate.
| Compound Name | methyl (1S,9R,10R,12S)-9-(3,3-diethoxypropyl)-9,12-dimethyl-10-prop-1-en-2-yl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene-5-carboxylate |
|---|---|
| PubChem CID | 10916764 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | methyl (1S,9R,10R,12S)-9-(3,3-diethoxypropyl)-9,12-dimethyl-10-prop-1-en-2-yl-2-oxatricyclo[6.3.1.04,12]dodeca-4,7-diene-5-carboxylate |
| SMILES | C=C(C)[C@H]1C[C@@H]2OCC3=C(C(=O)OC)CC=C([C@@]32C)[C@]1(C)CCC(OCC)OCC |
| InChI | InChI=1S/C25H38O5/c1-8-28-22(29-9-2)12-13-24(5)18(16(3)4)14-21-25(6)19(15-30-21)17(23(26)27-7)10-11-20(24)25/h11,18,21-22H,3,8-10,12-15H2,1-2,4-7H3/t18-,21+,24-,25-/m1/s1 |
| InChIKey | JXLZOKROHLLBMT-KWACHACRSA-N |
| XLogP | 4.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|