C18H30O4 — CID 11023317
(1S,3R,4R,6S)-3-(3,3-diethoxypropyl)-1,3-dimethyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one (PubChem CID 11023317) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is (1S,3R,4R,6S)-3-(3,3-diethoxypropyl)-1,3-dimethyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one.
| Compound Name | (1S,3R,4R,6S)-3-(3,3-diethoxypropyl)-1,3-dimethyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one |
|---|---|
| PubChem CID | 11023317 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | (1S,3R,4R,6S)-3-(3,3-diethoxypropyl)-1,3-dimethyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]heptan-2-one |
| SMILES | C=C(C)[C@H]1C[C@@H]2O[C@]2(C)C(=O)[C@]1(C)CCC(OCC)OCC |
| InChI | InChI=1S/C18H30O4/c1-7-20-15(21-8-2)9-10-17(5)13(12(3)4)11-14-18(6,22-14)16(17)19/h13-15H,3,7-11H2,1-2,4-6H3/t13-,14+,17-,18+/m1/s1 |
| InChIKey | ATUNCTPMIXEDKQ-NONVJHHQSA-N |
| XLogP | 3.49 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|