C21H30O3 — CID 11278945
methyl (2S,9R,16R)-2,6,6,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),12-diene-13-carboxylate (PubChem CID 11278945) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is methyl (2S,9R,16R)-2,6,6,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),12-diene-13-carboxylate.
| Compound Name | methyl (2S,9R,16R)-2,6,6,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),12-diene-13-carboxylate |
|---|---|
| PubChem CID | 11278945 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | methyl (2S,9R,16R)-2,6,6,16-tetramethyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),12-diene-13-carboxylate |
| SMILES | COC(=O)C1=C2CO[C@@H]3CC4C(C)(C)CCC[C@]4(C)C(=CC1)[C@]23C |
| InChI | InChI=1S/C21H30O3/c1-19(2)9-6-10-20(3)15-8-7-13(18(22)23-5)14-12-24-17(11-16(19)20)21(14,15)4/h8,16-17H,6-7,9-12H2,1-5H3/t16?,17-,20-,21+/m1/s1 |
| InChIKey | QRZYQIRNAWSAJE-MNWPFIGISA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|