C34H46O5 — CID 134839619
dimethyl (4bR,10aS,10bR,12R,12aR)-4b,7,7,10a,12a-pentamethyl-12-phenylmethoxy-3,5,6,6a,8,9,10,10b,11,12-decahydrochrysene-1,2-dicarboxylate (PubChem CID 134839619) has the molecular formula C34H46O5 and a molecular weight of 534.74 g/mol. Its IUPAC name is dimethyl (4bR,10aS,10bR,12R,12aR)-4b,7,7,10a,12a-pentamethyl-12-phenylmethoxy-3,5,6,6a,8,9,10,10b,11,12-decahydrochrysene-1,2-dicarboxylate.
| Compound Name | dimethyl (4bR,10aS,10bR,12R,12aR)-4b,7,7,10a,12a-pentamethyl-12-phenylmethoxy-3,5,6,6a,8,9,10,10b,11,12-decahydrochrysene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134839619 |
| Molecular Formula | C34H46O5 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | dimethyl (4bR,10aS,10bR,12R,12aR)-4b,7,7,10a,12a-pentamethyl-12-phenylmethoxy-3,5,6,6a,8,9,10,10b,11,12-decahydrochrysene-1,2-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(C)C(=CC1)[C@]1(C)CCC3C(C)(C)CCC[C@]3(C)[C@H]1C[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C34H46O5/c1-31(2)17-11-18-32(3)24(31)16-19-33(4)25-15-14-23(29(35)37-6)28(30(36)38-7)34(25,5)27(20-26(32)33)39-21-22-12-9-8-10-13-22/h8-10,12-13,15,24,26-27H,11,14,16-21H2,1-7H3/t24?,26-,27-,32+,33+,34+/m1/s1 |
| InChIKey | MCGULYNVPFRNJE-NGCVHEJISA-N |
| XLogP | 7.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|