C24H50O3Si2 — CID 10917221
(3S,6R)-6-methyl-5-methylidene-3-triethylsilyloxy-7-tri(propan-2-yl)silyloxyheptanal (PubChem CID 10917221) has the molecular formula C24H50O3Si2 and a molecular weight of 442.83 g/mol. Its IUPAC name is (3S,6R)-6-methyl-5-methylidene-3-triethylsilyloxy-7-tri(propan-2-yl)silyloxyheptanal.
| Compound Name | (3S,6R)-6-methyl-5-methylidene-3-triethylsilyloxy-7-tri(propan-2-yl)silyloxyheptanal |
|---|---|
| PubChem CID | 10917221 |
| Molecular Formula | C24H50O3Si2 |
| Molecular Weight | 442.83 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | (3S,6R)-6-methyl-5-methylidene-3-triethylsilyloxy-7-tri(propan-2-yl)silyloxyheptanal |
| SMILES | C=C(C[C@@H](CC=O)O[Si](CC)(CC)CC)[C@@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H50O3Si2/c1-12-28(13-2,14-3)27-24(15-16-25)17-22(10)23(11)18-26-29(19(4)5,20(6)7)21(8)9/h16,19-21,23-24H,10,12-15,17-18H2,1-9,11H3/t23-,24+/m0/s1 |
| InChIKey | XSKJSLJFIBWSHJ-BJKOFHAPSA-N |
| XLogP | 7.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.83 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|