C28H57IO3Si2 — CID 66572022
(Z,2S,3R,6S,8S,9R,10S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodo-2,6,8,10-tetramethyldodec-11-enal (PubChem CID 66572022) has the molecular formula C28H57IO3Si2 and a molecular weight of 624.84 g/mol. Its IUPAC name is (Z,2S,3R,6S,8S,9R,10S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodo-2,6,8,10-tetramethyldodec-11-enal.
| Compound Name | (Z,2S,3R,6S,8S,9R,10S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodo-2,6,8,10-tetramethyldodec-11-enal |
|---|---|
| PubChem CID | 66572022 |
| Molecular Formula | C28H57IO3Si2 |
| Molecular Weight | 624.84 g/mol |
| Exact Mass | 624.29 |
| IUPAC Name | (Z,2S,3R,6S,8S,9R,10S)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-12-iodo-2,6,8,10-tetramethyldodec-11-enal |
| SMILES | CC(C=O)[C@@H](CC[C@H](C)C[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)/C=C\I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H57IO3Si2/c1-21(15-16-25(24(4)20-30)31-33(11,12)27(5,6)7)19-23(3)26(22(2)17-18-29)32-34(13,14)28(8,9)10/h17-18,20-26H,15-16,19H2,1-14H3/b18-17-/t21-,22-,23-,24?,25+,26-/m0/s1 |
| InChIKey | CPKPZLHWNLUMOE-VSHLYGEXSA-N |
| XLogP | 9.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.84 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|