C22H46O3Si2 — CID 102525146
(2S,3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyhept-6-enal (PubChem CID 102525146) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is (2S,3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyhept-6-enal.
| Compound Name | (2S,3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyhept-6-enal |
|---|---|
| PubChem CID | 102525146 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (2S,3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-3-triethylsilyloxyhept-6-enal |
| SMILES | C=C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@H](C)C=O |
| InChI | InChI=1S/C22H46O3Si2/c1-13-27(14-2,15-3)25-21(18(6)16-23)19(7)20(17(4)5)24-26(11,12)22(8,9)10/h16,18-21H,4,13-15H2,1-3,5-12H3/t18-,19-,20+,21+/m1/s1 |
| InChIKey | UVWXOJHRZUYEPC-CGXNFDGLSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|