C25H33NO7 — CID 10917510
2-(2,2-diethoxyethyl)-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one (PubChem CID 10917510) has the molecular formula C25H33NO7 and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-(2,2-diethoxyethyl)-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 10917510 |
| Molecular Formula | C25H33NO7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-3-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3,4-dihydroisoquinolin-1-one |
| SMILES | CCOC(CN1C(=O)c2cc(OC)c(OC)cc2CC1c1ccc(OC)c(OC)c1)OCC |
| InChI | InChI=1S/C25H33NO7/c1-7-32-24(33-8-2)15-26-19(16-9-10-20(28-3)21(12-16)29-4)11-17-13-22(30-5)23(31-6)14-18(17)25(26)27/h9-10,12-14,19,24H,7-8,11,15H2,1-6H3 |
| InChIKey | UZXSUSWYDTXYPG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|