C31H46O7SSi — CID 10919010
(1S,2R,4S,5R,6S,9R,12R,13S)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one (PubChem CID 10919010) has the molecular formula C31H46O7SSi and a molecular weight of 590.86 g/mol. Its IUPAC name is (1S,2R,4S,5R,6S,9R,12R,13S)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one.
| Compound Name | (1S,2R,4S,5R,6S,9R,12R,13S)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one |
|---|---|
| PubChem CID | 10919010 |
| Molecular Formula | C31H46O7SSi |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | (1S,2R,4S,5R,6S,9R,12R,13S)-15-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxy-13-hydroxy-5,17,17-trimethyl-3,11-dioxapentacyclo[11.3.1.12,5.04,9.04,12]octadecan-16-one |
| SMILES | CC1(C)[C@@H]2C(=O)C(S(=O)(=O)c3ccccc3)C[C@@]1(O)[C@H]1OC[C@H]3CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@]4(C)C[C@H]2O[C@]314 |
| InChI | InChI=1S/C31H46O7SSi/c1-27(2,3)40(7,8)38-23-15-14-19-18-36-26-30(33)17-22(39(34,35)20-12-10-9-11-13-20)25(32)24(28(30,4)5)21-16-29(23,6)31(19,26)37-21/h9-13,19,21-24,26,33H,14-18H2,1-8H3/t19-,21-,22?,23+,24+,26-,29-,30-,31-/m1/s1 |
| InChIKey | XRDCRWVUTBTYQN-XVXVYMAKSA-N |
| XLogP | 4.92 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|