C32H50O8SSi — CID 11028540
methyl (1R,2S,4S,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate (PubChem CID 11028540) has the molecular formula C32H50O8SSi and a molecular weight of 622.90 g/mol. Its IUPAC name is methyl (1R,2S,4S,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate.
| Compound Name | methyl (1R,2S,4S,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate |
|---|---|
| PubChem CID | 11028540 |
| Molecular Formula | C32H50O8SSi |
| Molecular Weight | 622.90 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | methyl (1R,2S,4S,5R,8R,11S,12R,13S)-4-[2-(benzenesulfonyl)ethyl]-11-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3,12-trimethyl-6,14-dioxatetracyclo[10.2.1.05,13.08,13]pentadecane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@]3(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]4CO[C@@H]([C@]43O2)[C@](O)(CCS(=O)(=O)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C32H50O8SSi/c1-28(2,3)42(8,9)40-24-16-15-21-20-38-27-31(34,17-18-41(35,36)22-13-11-10-12-14-22)29(4,5)25(26(33)37-7)23-19-30(24,6)32(21,27)39-23/h10-14,21,23-25,27,34H,15-20H2,1-9H3/t21-,23-,24+,25+,27-,30-,31-,32-/m1/s1 |
| InChIKey | RFPIGBAFWBJJOD-WTVCXAIMSA-N |
| XLogP | 5.14 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.90 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|